C22H23ClN4 — CID 159919598
N-(4-chlorophenyl)-4-(pyridin-4-ylmethyl)phthalazin-1-amine;methane (PubChem CID 159919598) has the molecular formula C22H23ClN4 and a molecular weight of 378.91 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-(pyridin-4-ylmethyl)phthalazin-1-amine;methane.
| Compound Name | N-(4-chlorophenyl)-4-(pyridin-4-ylmethyl)phthalazin-1-amine;methane |
|---|---|
| PubChem CID | 159919598 |
| Molecular Formula | C22H23ClN4 |
| Molecular Weight | 378.91 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N-(4-chlorophenyl)-4-(pyridin-4-ylmethyl)phthalazin-1-amine;methane |
| SMILES | C.C.Clc1ccc(Nc2nnc(Cc3ccncc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C20H15ClN4.2CH4/c21-15-5-7-16(8-6-15)23-20-18-4-2-1-3-17(18)19(24-25-20)13-14-9-11-22-12-10-14;;/h1-12H,13H2,(H,23,25);2*1H4 |
| InChIKey | NYFLZXSUIDUPOA-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.91 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |