C7H3Cl2NO — CID 67983088
3,6-dichloro-2,1-benzoxazole (PubChem CID 67983088) has the molecular formula C7H3Cl2NO and a molecular weight of 188.01 g/mol. Its IUPAC name is 3,6-dichloro-2,1-benzoxazole.
| Compound Name | 3,6-dichloro-2,1-benzoxazole |
|---|---|
| PubChem CID | 67983088 |
| Molecular Formula | C7H3Cl2NO |
| Molecular Weight | 188.01 g/mol |
| Exact Mass | 186.96 |
| IUPAC Name | 3,6-dichloro-2,1-benzoxazole |
| SMILES | Clc1ccc2c(Cl)onc2c1 |
| InChI | InChI=1S/C7H3Cl2NO/c8-4-1-2-5-6(3-4)10-11-7(5)9/h1-3H |
| InChIKey | UELYHQUTZZZZGL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.01 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |