C8H7ClN2O — CID 105440337
(5-chloro-2,1-benzoxazol-3-yl)methanamine (PubChem CID 105440337) has the molecular formula C8H7ClN2O and a molecular weight of 182.61 g/mol. Its IUPAC name is (5-chloro-2,1-benzoxazol-3-yl)methanamine.
| Compound Name | (5-chloro-2,1-benzoxazol-3-yl)methanamine |
|---|---|
| PubChem CID | 105440337 |
| Molecular Formula | C8H7ClN2O |
| Molecular Weight | 182.61 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | (5-chloro-2,1-benzoxazol-3-yl)methanamine |
| SMILES | NCc1onc2ccc(Cl)cc12 |
| InChI | InChI=1S/C8H7ClN2O/c9-5-1-2-7-6(3-5)8(4-10)12-11-7/h1-3H,4,10H2 |
| InChIKey | NOYFABFULVVTOP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.61 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |