C9H7Cl2N3 — CID 105485144
(4,6-dichloroquinazolin-2-yl)methanamine (PubChem CID 105485144) has the molecular formula C9H7Cl2N3 and a molecular weight of 228.08 g/mol. Its IUPAC name is (4,6-dichloroquinazolin-2-yl)methanamine.
| Compound Name | (4,6-dichloroquinazolin-2-yl)methanamine |
|---|---|
| PubChem CID | 105485144 |
| Molecular Formula | C9H7Cl2N3 |
| Molecular Weight | 228.08 g/mol |
| Exact Mass | 227.00 |
| IUPAC Name | (4,6-dichloroquinazolin-2-yl)methanamine |
| SMILES | NCc1nc(Cl)c2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C9H7Cl2N3/c10-5-1-2-7-6(3-5)9(11)14-8(4-12)13-7/h1-3H,4,12H2 |
| InChIKey | UTNJYQXAPVFQFX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.08 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |