C8H7ClN4 — CID 117274576
(4-chloropyrido[2,3-d]pyrimidin-2-yl)methanamine (PubChem CID 117274576) has the molecular formula C8H7ClN4 and a molecular weight of 194.62 g/mol. Its IUPAC name is (4-chloropyrido[2,3-d]pyrimidin-2-yl)methanamine.
| Compound Name | (4-chloropyrido[2,3-d]pyrimidin-2-yl)methanamine |
|---|---|
| PubChem CID | 117274576 |
| Molecular Formula | C8H7ClN4 |
| Molecular Weight | 194.62 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | (4-chloropyrido[2,3-d]pyrimidin-2-yl)methanamine |
| SMILES | NCc1nc(Cl)c2cccnc2n1 |
| InChI | InChI=1S/C8H7ClN4/c9-7-5-2-1-3-11-8(5)13-6(4-10)12-7/h1-3H,4,10H2 |
| InChIKey | MYFZPFRYMWUGBZ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.62 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |