C15H8ClN3S — CID 59130375
2-(1-benzothiophen-2-yl)-4-chloropyrido[2,3-d]pyrimidine (PubChem CID 59130375) has the molecular formula C15H8ClN3S and a molecular weight of 297.77 g/mol. Its IUPAC name is 2-(1-benzothiophen-2-yl)-4-chloropyrido[2,3-d]pyrimidine.
| Compound Name | 2-(1-benzothiophen-2-yl)-4-chloropyrido[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 59130375 |
| Molecular Formula | C15H8ClN3S |
| Molecular Weight | 297.77 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 2-(1-benzothiophen-2-yl)-4-chloropyrido[2,3-d]pyrimidine |
| SMILES | Clc1nc(-c2cc3ccccc3s2)nc2ncccc12 |
| InChI | InChI=1S/C15H8ClN3S/c16-13-10-5-3-7-17-14(10)19-15(18-13)12-8-9-4-1-2-6-11(9)20-12/h1-8H |
| InChIKey | VIILLCLNVSHWEG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.77 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |