C13H16N2O — CID 105470000
(3-cyclopentyl-2,1-benzoxazol-5-yl)methanamine (PubChem CID 105470000) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is (3-cyclopentyl-2,1-benzoxazol-5-yl)methanamine.
| Compound Name | (3-cyclopentyl-2,1-benzoxazol-5-yl)methanamine |
|---|---|
| PubChem CID | 105470000 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | (3-cyclopentyl-2,1-benzoxazol-5-yl)methanamine |
| SMILES | NCc1ccc2noc(C3CCCC3)c2c1 |
| InChI | InChI=1S/C13H16N2O/c14-8-9-5-6-12-11(7-9)13(16-15-12)10-3-1-2-4-10/h5-7,10H,1-4,8,14H2 |
| InChIKey | PECBLRGHHFJDPQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |