C10H10N2O — CID 105435770
3-cyclopropyl-2,1-benzoxazol-5-amine (PubChem CID 105435770) has the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. Its IUPAC name is 3-cyclopropyl-2,1-benzoxazol-5-amine.
| Compound Name | 3-cyclopropyl-2,1-benzoxazol-5-amine |
|---|---|
| PubChem CID | 105435770 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 3-cyclopropyl-2,1-benzoxazol-5-amine |
| SMILES | Nc1ccc2noc(C3CC3)c2c1 |
| InChI | InChI=1S/C10H10N2O/c11-7-3-4-9-8(5-7)10(13-12-9)6-1-2-6/h3-6H,1-2,11H2 |
| InChIKey | XJHUHSUKTOIDDL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|