C8H12N2O — CID 105429702
(5-cyclobutyl-1,2-oxazol-4-yl)methanamine (PubChem CID 105429702) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is (5-cyclobutyl-1,2-oxazol-4-yl)methanamine.
| Compound Name | (5-cyclobutyl-1,2-oxazol-4-yl)methanamine |
|---|---|
| PubChem CID | 105429702 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | (5-cyclobutyl-1,2-oxazol-4-yl)methanamine |
| SMILES | NCc1cnoc1C1CCC1 |
| InChI | InChI=1S/C8H12N2O/c9-4-7-5-10-11-8(7)6-2-1-3-6/h5-6H,1-4,9H2 |
| InChIKey | XFXORFPEKSMNHZ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |