C8H12N2O — CID 83826375
2-(5-cyclopropyl-1,2-oxazol-4-yl)ethanamine (PubChem CID 83826375) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is 2-(5-cyclopropyl-1,2-oxazol-4-yl)ethanamine.
| Compound Name | 2-(5-cyclopropyl-1,2-oxazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 83826375 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 2-(5-cyclopropyl-1,2-oxazol-4-yl)ethanamine |
| SMILES | NCCc1cnoc1C1CC1 |
| InChI | InChI=1S/C8H12N2O/c9-4-3-7-5-10-11-8(7)6-1-2-6/h5-6H,1-4,9H2 |
| InChIKey | JUUBEXSVGSSNHW-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |