About 4-cyclopentyl-5-piperidin-4-yl-1,2-oxazole
4-cyclopentyl-5-piperidin-4-yl-1,2-oxazole (PubChem CID 115032274) has the molecular formula C13H20N2O
and a molecular weight of 220.32 g/mol. Its IUPAC name is 4-cyclopentyl-5-piperidin-4-yl-1,2-oxazole.
Molecular Properties
| Compound Name | 4-cyclopentyl-5-piperidin-4-yl-1,2-oxazole |
| PubChem CID | 115032274 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 4-cyclopentyl-5-piperidin-4-yl-1,2-oxazole |
| SMILES | c1noc(C2CCNCC2)c1C1CCCC1 |
| InChI | InChI=1S/C13H20N2O/c1-2-4-10(3-1)12-9-15-16-13(12)11-5-7-14-8-6-11/h9-11,14H,1-8H2 |
| InChIKey | FKITVONBCSNIOY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-cyclopentyl-5-piperidin-4-yl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopentyl-5-piperidin-4-yl-1,2-oxazole?
The IUPAC name of 4-cyclopentyl-5-piperidin-4-yl-1,2-oxazole (CID 115032274) is 4-cyclopentyl-5-piperidin-4-yl-1,2-oxazole.
What is the SMILES notation for 4-cyclopentyl-5-piperidin-4-yl-1,2-oxazole?
The canonical SMILES for 4-cyclopentyl-5-piperidin-4-yl-1,2-oxazole is c1noc(C2CCNCC2)c1C1CCCC1.
What is the InChIKey of 4-cyclopentyl-5-piperidin-4-yl-1,2-oxazole?
The InChIKey is FKITVONBCSNIOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O/c1-2-4-10(3-1)12-9-15-16-13(12)11-5-7-14-8-6-11/h9-11,14H,1-8H2.
What are the key properties of 4-cyclopentyl-5-piperidin-4-yl-1,2-oxazole?
4-cyclopentyl-5-piperidin-4-yl-1,2-oxazole has a molecular weight of 220.32 g/mol, XLogP of 2.80, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopentyl-5-piperidin-4-yl-1,2-oxazole is sourced from PubChem (CID 115032274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).