C11H17NO — CID 140925382
4-cyclopentyl-5-propan-2-yl-1,2-oxazole (PubChem CID 140925382) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 4-cyclopentyl-5-propan-2-yl-1,2-oxazole.
| Compound Name | 4-cyclopentyl-5-propan-2-yl-1,2-oxazole |
|---|---|
| PubChem CID | 140925382 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 4-cyclopentyl-5-propan-2-yl-1,2-oxazole |
| SMILES | CC(C)c1oncc1C1CCCC1 |
| InChI | InChI=1S/C11H17NO/c1-8(2)11-10(7-12-13-11)9-5-3-4-6-9/h7-9H,3-6H2,1-2H3 |
| InChIKey | ZGAIPJFNVNQNOZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |