About 4-ethyl-5-propan-2-yl-1,2-oxazole
4-ethyl-5-propan-2-yl-1,2-oxazole (PubChem CID 118928258) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is 4-ethyl-5-propan-2-yl-1,2-oxazole.
Molecular Properties
| Compound Name | 4-ethyl-5-propan-2-yl-1,2-oxazole |
| PubChem CID | 118928258 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 4-ethyl-5-propan-2-yl-1,2-oxazole |
| SMILES | CCc1cnoc1C(C)C |
| InChI | InChI=1S/C8H13NO/c1-4-7-5-9-10-8(7)6(2)3/h5-6H,4H2,1-3H3 |
| InChIKey | NYKZALXUKVMJRJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethyl-5-propan-2-yl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-5-propan-2-yl-1,2-oxazole?
The IUPAC name of 4-ethyl-5-propan-2-yl-1,2-oxazole (CID 118928258) is 4-ethyl-5-propan-2-yl-1,2-oxazole.
What is the SMILES notation for 4-ethyl-5-propan-2-yl-1,2-oxazole?
The canonical SMILES for 4-ethyl-5-propan-2-yl-1,2-oxazole is CCc1cnoc1C(C)C.
What is the InChIKey of 4-ethyl-5-propan-2-yl-1,2-oxazole?
The InChIKey is NYKZALXUKVMJRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO/c1-4-7-5-9-10-8(7)6(2)3/h5-6H,4H2,1-3H3.
What are the key properties of 4-ethyl-5-propan-2-yl-1,2-oxazole?
4-ethyl-5-propan-2-yl-1,2-oxazole has a molecular weight of 139.20 g/mol, XLogP of 2.36, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-5-propan-2-yl-1,2-oxazole is sourced from PubChem (CID 118928258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).