C12H20N2O — CID 105462134
(5-cycloheptyl-3-methyl-1,2-oxazol-4-yl)methanamine (PubChem CID 105462134) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is (5-cycloheptyl-3-methyl-1,2-oxazol-4-yl)methanamine.
| Compound Name | (5-cycloheptyl-3-methyl-1,2-oxazol-4-yl)methanamine |
|---|---|
| PubChem CID | 105462134 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | (5-cycloheptyl-3-methyl-1,2-oxazol-4-yl)methanamine |
| SMILES | Cc1noc(C2CCCCCC2)c1CN |
| InChI | InChI=1S/C12H20N2O/c1-9-11(8-13)12(15-14-9)10-6-4-2-3-5-7-10/h10H,2-8,13H2,1H3 |
| InChIKey | XXXBYQKKVBPOQD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |