C11H15NO3 — CID 105462752
2-(5-cyclopentyl-3-methyl-1,2-oxazol-4-yl)acetic acid (PubChem CID 105462752) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 2-(5-cyclopentyl-3-methyl-1,2-oxazol-4-yl)acetic acid.
| Compound Name | 2-(5-cyclopentyl-3-methyl-1,2-oxazol-4-yl)acetic acid |
|---|---|
| PubChem CID | 105462752 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 2-(5-cyclopentyl-3-methyl-1,2-oxazol-4-yl)acetic acid |
| SMILES | Cc1noc(C2CCCC2)c1CC(=O)O |
| InChI | InChI=1S/C11H15NO3/c1-7-9(6-10(13)14)11(15-12-7)8-4-2-3-5-8/h8H,2-6H2,1H3,(H,13,14) |
| InChIKey | UYRYGZOKKPEFGX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |