2-(5-cyclopentyl-3-methyl-1,2-oxazol-4-yl)acetic acid

C11H15NO3 — CID 105462752

IUPAC2-(5-cyclopentyl-3-methyl-1,2-oxazol-4-yl)acetic acid
SMILESCc1noc(C2CCCC2)c1CC(=O)O
InChIInChI=1S/C11H15NO3/c1-7-9(6-10(13)14)11(15-12-7)8-4-2-3-5-8/h8H,2-6H2,1H3,(H,13,14)
InChIKeyUYRYGZOKKPEFGX-UHFFFAOYSA-N
MW209.24 g/mol
LogP2.27
Rot. Bonds3

About 2-(5-cyclopentyl-3-methyl-1,2-oxazol-4-yl)acetic acid

2-(5-cyclopentyl-3-methyl-1,2-oxazol-4-yl)acetic acid (PubChem CID 105462752) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 2-(5-cyclopentyl-3-methyl-1,2-oxazol-4-yl)acetic acid.

Molecular Properties

Compound Name2-(5-cyclopentyl-3-methyl-1,2-oxazol-4-yl)acetic acid
PubChem CID105462752
Molecular FormulaC11H15NO3
Molecular Weight209.24 g/mol
Exact Mass209.11
IUPAC Name2-(5-cyclopentyl-3-methyl-1,2-oxazol-4-yl)acetic acid
SMILESCc1noc(C2CCCC2)c1CC(=O)O
InChIInChI=1S/C11H15NO3/c1-7-9(6-10(13)14)11(15-12-7)8-4-2-3-5-8/h8H,2-6H2,1H3,(H,13,14)
InChIKeyUYRYGZOKKPEFGX-UHFFFAOYSA-N
XLogP2.27
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.24
LogP ≤ 52.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(5-cyclopentyl-3-methyl-1,2-oxazol-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-cyclopentyl-3-methyl-1,2-oxazol-4-yl)acetic acid?
The IUPAC name of 2-(5-cyclopentyl-3-methyl-1,2-oxazol-4-yl)acetic acid (CID 105462752) is 2-(5-cyclopentyl-3-methyl-1,2-oxazol-4-yl)acetic acid.
What is the SMILES notation for 2-(5-cyclopentyl-3-methyl-1,2-oxazol-4-yl)acetic acid?
The canonical SMILES for 2-(5-cyclopentyl-3-methyl-1,2-oxazol-4-yl)acetic acid is Cc1noc(C2CCCC2)c1CC(=O)O.
What is the InChIKey of 2-(5-cyclopentyl-3-methyl-1,2-oxazol-4-yl)acetic acid?
The InChIKey is UYRYGZOKKPEFGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO3/c1-7-9(6-10(13)14)11(15-12-7)8-4-2-3-5-8/h8H,2-6H2,1H3,(H,13,14).
What are the key properties of 2-(5-cyclopentyl-3-methyl-1,2-oxazol-4-yl)acetic acid?
2-(5-cyclopentyl-3-methyl-1,2-oxazol-4-yl)acetic acid has a molecular weight of 209.24 g/mol, XLogP of 2.27, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-cyclopentyl-3-methyl-1,2-oxazol-4-yl)acetic acid is sourced from PubChem (CID 105462752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).