C19H23NO3 — CID 55368439
(4-cyclohexylphenyl) 2-(3,5-dimethyl-1,2-oxazol-4-yl)acetate (PubChem CID 55368439) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is (4-cyclohexylphenyl) 2-(3,5-dimethyl-1,2-oxazol-4-yl)acetate.
| Compound Name | (4-cyclohexylphenyl) 2-(3,5-dimethyl-1,2-oxazol-4-yl)acetate |
|---|---|
| PubChem CID | 55368439 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (4-cyclohexylphenyl) 2-(3,5-dimethyl-1,2-oxazol-4-yl)acetate |
| SMILES | Cc1noc(C)c1CC(=O)Oc1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C19H23NO3/c1-13-18(14(2)23-20-13)12-19(21)22-17-10-8-16(9-11-17)15-6-4-3-5-7-15/h8-11,15H,3-7,12H2,1-2H3 |
| InChIKey | KRJKFKUECGHJSC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|