C15H15N3O3 — CID 90538252
(1-methylbenzimidazol-5-yl) 2-(3,5-dimethyl-1,2-oxazol-4-yl)acetate (PubChem CID 90538252) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is (1-methylbenzimidazol-5-yl) 2-(3,5-dimethyl-1,2-oxazol-4-yl)acetate.
| Compound Name | (1-methylbenzimidazol-5-yl) 2-(3,5-dimethyl-1,2-oxazol-4-yl)acetate |
|---|---|
| PubChem CID | 90538252 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | (1-methylbenzimidazol-5-yl) 2-(3,5-dimethyl-1,2-oxazol-4-yl)acetate |
| SMILES | Cc1noc(C)c1CC(=O)Oc1ccc2c(c1)ncn2C |
| InChI | InChI=1S/C15H15N3O3/c1-9-12(10(2)21-17-9)7-15(19)20-11-4-5-14-13(6-11)16-8-18(14)3/h4-6,8H,7H2,1-3H3 |
| InChIKey | SUOFMFSCLOADKI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|