C19H14N4O4 — CID 90538243
(1-methylbenzimidazol-5-yl) 3-(1,3-benzodioxol-5-yl)-1H-pyrazole-5-carboxylate (PubChem CID 90538243) has the molecular formula C19H14N4O4 and a molecular weight of 362.35 g/mol. Its IUPAC name is (1-methylbenzimidazol-5-yl) 3-(1,3-benzodioxol-5-yl)-1H-pyrazole-5-carboxylate.
| Compound Name | (1-methylbenzimidazol-5-yl) 3-(1,3-benzodioxol-5-yl)-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 90538243 |
| Molecular Formula | C19H14N4O4 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | (1-methylbenzimidazol-5-yl) 3-(1,3-benzodioxol-5-yl)-1H-pyrazole-5-carboxylate |
| SMILES | Cn1cnc2cc(OC(=O)c3cc(-c4ccc5c(c4)OCO5)n[nH]3)ccc21 |
| InChI | InChI=1S/C19H14N4O4/c1-23-9-20-14-7-12(3-4-16(14)23)27-19(24)15-8-13(21-22-15)11-2-5-17-18(6-11)26-10-25-17/h2-9H,10H2,1H3,(H,21,22) |
| InChIKey | VBAKLABGWDFZGM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|