C17H13N3O2S2 — CID 90538029
(1-methylbenzimidazol-5-yl) 2-(1,3-benzothiazol-2-ylsulfanyl)acetate (PubChem CID 90538029) has the molecular formula C17H13N3O2S2 and a molecular weight of 355.44 g/mol. Its IUPAC name is (1-methylbenzimidazol-5-yl) 2-(1,3-benzothiazol-2-ylsulfanyl)acetate.
| Compound Name | (1-methylbenzimidazol-5-yl) 2-(1,3-benzothiazol-2-ylsulfanyl)acetate |
|---|---|
| PubChem CID | 90538029 |
| Molecular Formula | C17H13N3O2S2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | (1-methylbenzimidazol-5-yl) 2-(1,3-benzothiazol-2-ylsulfanyl)acetate |
| SMILES | Cn1cnc2cc(OC(=O)CSc3nc4ccccc4s3)ccc21 |
| InChI | InChI=1S/C17H13N3O2S2/c1-20-10-18-13-8-11(6-7-14(13)20)22-16(21)9-23-17-19-12-4-2-3-5-15(12)24-17/h2-8,10H,9H2,1H3 |
| InChIKey | VVAQXPXZAUWHTE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|