C19H24N2O2 — CID 97313180
2-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(2R)-2-phenylazepan-1-yl]ethanone (PubChem CID 97313180) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(2R)-2-phenylazepan-1-yl]ethanone.
| Compound Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(2R)-2-phenylazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 97313180 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(2R)-2-phenylazepan-1-yl]ethanone |
| SMILES | Cc1noc(C)c1CC(=O)N1CCCCC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H24N2O2/c1-14-17(15(2)23-20-14)13-19(22)21-12-8-4-7-11-18(21)16-9-5-3-6-10-16/h3,5-6,9-10,18H,4,7-8,11-13H2,1-2H3/t18-/m1/s1 |
| InChIKey | HAVVFWCRRDJPGC-GOSISDBHSA-N |
| XLogP | 3.98 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |