C25H33N3O3 — CID 110137373
1-[(2S,3aS,9aS)-4-acetyl-3a-methyl-2-phenyl-2,3,5,6,7,8,9,9a-octahydropyrrolo[3,2-b]azocin-1-yl]-2-(3,5-dimethyl-1,2-oxazol-4-yl)ethanone (PubChem CID 110137373) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is 1-[(2S,3aS,9aS)-4-acetyl-3a-methyl-2-phenyl-2,3,5,6,7,8,9,9a-octahydropyrrolo[3,2-b]azocin-1-yl]-2-(3,5-dimethyl-1,2-oxazol-4-yl)ethanone.
| Compound Name | 1-[(2S,3aS,9aS)-4-acetyl-3a-methyl-2-phenyl-2,3,5,6,7,8,9,9a-octahydropyrrolo[3,2-b]azocin-1-yl]-2-(3,5-dimethyl-1,2-oxazol-4-yl)ethanone |
|---|---|
| PubChem CID | 110137373 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | 1-[(2S,3aS,9aS)-4-acetyl-3a-methyl-2-phenyl-2,3,5,6,7,8,9,9a-octahydropyrrolo[3,2-b]azocin-1-yl]-2-(3,5-dimethyl-1,2-oxazol-4-yl)ethanone |
| SMILES | CC(=O)N1CCCCC[C@@H]2N(C(=O)Cc3c(C)noc3C)[C@H](c3ccccc3)C[C@@]21C |
| InChI | InChI=1S/C25H33N3O3/c1-17-21(18(2)31-26-17)15-24(30)28-22(20-11-7-5-8-12-20)16-25(4)23(28)13-9-6-10-14-27(25)19(3)29/h5,7-8,11-12,22-23H,6,9-10,13-16H2,1-4H3/t22-,23-,25-/m0/s1 |
| InChIKey | AFDKLUNSSNJWAO-LSQMVHIFSA-N |
| XLogP | 4.36 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |