C20H30N2O2 — CID 110137313
1-[(2S,3aS,9aS)-4-(2-hydroxyethyl)-3a-methyl-2-phenyl-2,3,5,6,7,8,9,9a-octahydropyrrolo[3,2-b]azocin-1-yl]ethanone (PubChem CID 110137313) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is 1-[(2S,3aS,9aS)-4-(2-hydroxyethyl)-3a-methyl-2-phenyl-2,3,5,6,7,8,9,9a-octahydropyrrolo[3,2-b]azocin-1-yl]ethanone.
| Compound Name | 1-[(2S,3aS,9aS)-4-(2-hydroxyethyl)-3a-methyl-2-phenyl-2,3,5,6,7,8,9,9a-octahydropyrrolo[3,2-b]azocin-1-yl]ethanone |
|---|---|
| PubChem CID | 110137313 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 1-[(2S,3aS,9aS)-4-(2-hydroxyethyl)-3a-methyl-2-phenyl-2,3,5,6,7,8,9,9a-octahydropyrrolo[3,2-b]azocin-1-yl]ethanone |
| SMILES | CC(=O)N1[C@H]2CCCCCN(CCO)[C@@]2(C)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H30N2O2/c1-16(24)22-18(17-9-5-3-6-10-17)15-20(2)19(22)11-7-4-8-12-21(20)13-14-23/h3,5-6,9-10,18-19,23H,4,7-8,11-15H2,1-2H3/t18-,19-,20-/m0/s1 |
| InChIKey | SPBNYQFXCPTLPD-UFYCRDLUSA-N |
| XLogP | 2.98 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |