C24H35NO4 — CID 110153592
1-[(2R,3aR,4R,5R,8aR)-4,5-dihydroxy-3a-methyl-2-phenyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrol-1-yl]-2-(1-hydroxycyclohexyl)ethanone (PubChem CID 110153592) has the molecular formula C24H35NO4 and a molecular weight of 401.55 g/mol. Its IUPAC name is 1-[(2R,3aR,4R,5R,8aR)-4,5-dihydroxy-3a-methyl-2-phenyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrol-1-yl]-2-(1-hydroxycyclohexyl)ethanone.
| Compound Name | 1-[(2R,3aR,4R,5R,8aR)-4,5-dihydroxy-3a-methyl-2-phenyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrol-1-yl]-2-(1-hydroxycyclohexyl)ethanone |
|---|---|
| PubChem CID | 110153592 |
| Molecular Formula | C24H35NO4 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | 1-[(2R,3aR,4R,5R,8aR)-4,5-dihydroxy-3a-methyl-2-phenyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrol-1-yl]-2-(1-hydroxycyclohexyl)ethanone |
| SMILES | C[C@@]12C[C@H](c3ccccc3)N(C(=O)CC3(O)CCCCC3)[C@@H]1CCC[C@@H](O)[C@@H]2O |
| InChI | InChI=1S/C24H35NO4/c1-23-15-18(17-9-4-2-5-10-17)25(20(23)12-8-11-19(26)22(23)28)21(27)16-24(29)13-6-3-7-14-24/h2,4-5,9-10,18-20,22,26,28-29H,3,6-8,11-16H2,1H3/t18-,19-,20-,22+,23-/m1/s1 |
| InChIKey | NARVGZXDEYNFBS-VOUHSTLWSA-N |
| XLogP | 3.33 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |