C26H34N2O4 — CID 155984242
[(2R,3aR,4R,5S,8aR)-4,5-dihydroxy-3a-methyl-2-phenyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrol-1-yl]-[4-(3-aminopropoxy)phenyl]methanone (PubChem CID 155984242) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is [(2R,3aR,4R,5S,8aR)-4,5-dihydroxy-3a-methyl-2-phenyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrol-1-yl]-[4-(3-aminopropoxy)phenyl]methanone.
| Compound Name | [(2R,3aR,4R,5S,8aR)-4,5-dihydroxy-3a-methyl-2-phenyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrol-1-yl]-[4-(3-aminopropoxy)phenyl]methanone |
|---|---|
| PubChem CID | 155984242 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | [(2R,3aR,4R,5S,8aR)-4,5-dihydroxy-3a-methyl-2-phenyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrol-1-yl]-[4-(3-aminopropoxy)phenyl]methanone |
| SMILES | C[C@@]12C[C@H](c3ccccc3)N(C(=O)c3ccc(OCCCN)cc3)[C@@H]1CCC[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C26H34N2O4/c1-26-17-21(18-7-3-2-4-8-18)28(23(26)10-5-9-22(29)24(26)30)25(31)19-11-13-20(14-12-19)32-16-6-15-27/h2-4,7-8,11-14,21-24,29-30H,5-6,9-10,15-17,27H2,1H3/t21-,22+,23-,24+,26-/m1/s1 |
| InChIKey | OMRQMIXTGKHYDD-CAIUVPPLSA-N |
| XLogP | 3.28 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|