C24H28FN3O3 — CID 155984241
(2S,3aR,8aS)-1-[4-(3-aminopropoxy)benzoyl]-2-(4-fluorophenyl)-2,3,3a,4,6,7,8,8a-octahydropyrrolo[3,2-b]azepin-5-one (PubChem CID 155984241) has the molecular formula C24H28FN3O3 and a molecular weight of 425.50 g/mol. Its IUPAC name is (2S,3aR,8aS)-1-[4-(3-aminopropoxy)benzoyl]-2-(4-fluorophenyl)-2,3,3a,4,6,7,8,8a-octahydropyrrolo[3,2-b]azepin-5-one.
| Compound Name | (2S,3aR,8aS)-1-[4-(3-aminopropoxy)benzoyl]-2-(4-fluorophenyl)-2,3,3a,4,6,7,8,8a-octahydropyrrolo[3,2-b]azepin-5-one |
|---|---|
| PubChem CID | 155984241 |
| Molecular Formula | C24H28FN3O3 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | (2S,3aR,8aS)-1-[4-(3-aminopropoxy)benzoyl]-2-(4-fluorophenyl)-2,3,3a,4,6,7,8,8a-octahydropyrrolo[3,2-b]azepin-5-one |
| SMILES | NCCCOc1ccc(C(=O)N2[C@H](c3ccc(F)cc3)C[C@H]3NC(=O)CCC[C@@H]32)cc1 |
| InChI | InChI=1S/C24H28FN3O3/c25-18-9-5-16(6-10-18)22-15-20-21(3-1-4-23(29)27-20)28(22)24(30)17-7-11-19(12-8-17)31-14-2-13-26/h5-12,20-22H,1-4,13-15,26H2,(H,27,29)/t20-,21+,22+/m1/s1 |
| InChIKey | GRKXRZHSNQGKME-FSSWDIPSSA-N |
| XLogP | 3.18 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|