C20H28N2O4 — CID 110136786
(3aS,9aR)-1-[4-(4-methoxyphenoxy)butanoyl]-3,3a,4,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocin-5-one (PubChem CID 110136786) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is (3aS,9aR)-1-[4-(4-methoxyphenoxy)butanoyl]-3,3a,4,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocin-5-one.
| Compound Name | (3aS,9aR)-1-[4-(4-methoxyphenoxy)butanoyl]-3,3a,4,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocin-5-one |
|---|---|
| PubChem CID | 110136786 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | (3aS,9aR)-1-[4-(4-methoxyphenoxy)butanoyl]-3,3a,4,6,7,8,9,9a-octahydro-2H-pyrrolo[3,2-b]azocin-5-one |
| SMILES | COc1ccc(OCCCC(=O)N2CC[C@@H]3NC(=O)CCCC[C@H]32)cc1 |
| InChI | InChI=1S/C20H28N2O4/c1-25-15-8-10-16(11-9-15)26-14-4-7-20(24)22-13-12-17-18(22)5-2-3-6-19(23)21-17/h8-11,17-18H,2-7,12-14H2,1H3,(H,21,23)/t17-,18+/m0/s1 |
| InChIKey | ICKFYDCDHLYAOH-ZWKOTPCHSA-N |
| XLogP | 2.51 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|