C17H27ClN2O3 — CID 119559826
4-(4-methoxyphenoxy)-1-[4-(methylamino)piperidin-1-yl]butan-1-one;hydrochloride (PubChem CID 119559826) has the molecular formula C17H27ClN2O3 and a molecular weight of 342.87 g/mol. Its IUPAC name is 4-(4-methoxyphenoxy)-1-[4-(methylamino)piperidin-1-yl]butan-1-one;hydrochloride.
| Compound Name | 4-(4-methoxyphenoxy)-1-[4-(methylamino)piperidin-1-yl]butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119559826 |
| Molecular Formula | C17H27ClN2O3 |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 4-(4-methoxyphenoxy)-1-[4-(methylamino)piperidin-1-yl]butan-1-one;hydrochloride |
| SMILES | CNC1CCN(C(=O)CCCOc2ccc(OC)cc2)CC1.Cl |
| InChI | InChI=1S/C17H26N2O3.ClH/c1-18-14-9-11-19(12-10-14)17(20)4-3-13-22-16-7-5-15(21-2)6-8-16;/h5-8,14,18H,3-4,9-13H2,1-2H3;1H |
| InChIKey | GTMNEDUPQHADCD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|