C19H30N2O3 — CID 119644268
1-[4-(ethylaminomethyl)piperidin-1-yl]-4-(4-methoxyphenoxy)butan-1-one (PubChem CID 119644268) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is 1-[4-(ethylaminomethyl)piperidin-1-yl]-4-(4-methoxyphenoxy)butan-1-one.
| Compound Name | 1-[4-(ethylaminomethyl)piperidin-1-yl]-4-(4-methoxyphenoxy)butan-1-one |
|---|---|
| PubChem CID | 119644268 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 1-[4-(ethylaminomethyl)piperidin-1-yl]-4-(4-methoxyphenoxy)butan-1-one |
| SMILES | CCNCC1CCN(C(=O)CCCOc2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C19H30N2O3/c1-3-20-15-16-10-12-21(13-11-16)19(22)5-4-14-24-18-8-6-17(23-2)7-9-18/h6-9,16,20H,3-5,10-15H2,1-2H3 |
| InChIKey | HREGNVKOPLMPKE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|