C23H31F2NO3 — CID 110153648
[(2R,3aR,4R,5S,8aR)-4,5-dihydroxy-3a-methyl-2-phenyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrol-1-yl]-(4,4-difluorocyclohexyl)methanone (PubChem CID 110153648) has the molecular formula C23H31F2NO3 and a molecular weight of 407.50 g/mol. Its IUPAC name is [(2R,3aR,4R,5S,8aR)-4,5-dihydroxy-3a-methyl-2-phenyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrol-1-yl]-(4,4-difluorocyclohexyl)methanone.
| Compound Name | [(2R,3aR,4R,5S,8aR)-4,5-dihydroxy-3a-methyl-2-phenyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrol-1-yl]-(4,4-difluorocyclohexyl)methanone |
|---|---|
| PubChem CID | 110153648 |
| Molecular Formula | C23H31F2NO3 |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | [(2R,3aR,4R,5S,8aR)-4,5-dihydroxy-3a-methyl-2-phenyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrol-1-yl]-(4,4-difluorocyclohexyl)methanone |
| SMILES | C[C@@]12C[C@H](c3ccccc3)N(C(=O)C3CCC(F)(F)CC3)[C@@H]1CCC[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C23H31F2NO3/c1-22-14-17(15-6-3-2-4-7-15)26(19(22)9-5-8-18(27)20(22)28)21(29)16-10-12-23(24,25)13-11-16/h2-4,6-7,16-20,27-28H,5,8-14H2,1H3/t17-,18+,19-,20+,22-/m1/s1 |
| InChIKey | ZONNFRVGLYFNCF-BFUACXKISA-N |
| XLogP | 4.07 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |