C24H28FNO3 — CID 110153452
1-[(2R,3aR,4R,5S,8aR)-4,5-dihydroxy-3a-methyl-2-phenyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrol-1-yl]-2-(2-fluorophenyl)ethanone (PubChem CID 110153452) has the molecular formula C24H28FNO3 and a molecular weight of 397.49 g/mol. Its IUPAC name is 1-[(2R,3aR,4R,5S,8aR)-4,5-dihydroxy-3a-methyl-2-phenyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrol-1-yl]-2-(2-fluorophenyl)ethanone.
| Compound Name | 1-[(2R,3aR,4R,5S,8aR)-4,5-dihydroxy-3a-methyl-2-phenyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrol-1-yl]-2-(2-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 110153452 |
| Molecular Formula | C24H28FNO3 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 1-[(2R,3aR,4R,5S,8aR)-4,5-dihydroxy-3a-methyl-2-phenyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrol-1-yl]-2-(2-fluorophenyl)ethanone |
| SMILES | C[C@@]12C[C@H](c3ccccc3)N(C(=O)Cc3ccccc3F)[C@@H]1CCC[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C24H28FNO3/c1-24-15-19(16-8-3-2-4-9-16)26(21(24)13-7-12-20(27)23(24)29)22(28)14-17-10-5-6-11-18(17)25/h2-6,8-11,19-21,23,27,29H,7,12-15H2,1H3/t19-,20+,21-,23+,24-/m1/s1 |
| InChIKey | OJSHNZFPFKIOQJ-PEKPJSAASA-N |
| XLogP | 3.62 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |