C21H30BrNO3 — CID 84819102
tert-butyl (2S,3aS,4R,8aS)-2-(2-bromophenyl)-4-hydroxy-3a-methyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrole-1-carboxylate (PubChem CID 84819102) has the molecular formula C21H30BrNO3 and a molecular weight of 424.38 g/mol. Its IUPAC name is tert-butyl (2S,3aS,4R,8aS)-2-(2-bromophenyl)-4-hydroxy-3a-methyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrole-1-carboxylate.
| Compound Name | tert-butyl (2S,3aS,4R,8aS)-2-(2-bromophenyl)-4-hydroxy-3a-methyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 84819102 |
| Molecular Formula | C21H30BrNO3 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | tert-butyl (2S,3aS,4R,8aS)-2-(2-bromophenyl)-4-hydroxy-3a-methyl-2,3,4,5,6,7,8,8a-octahydrocyclohepta[b]pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H]2CCCC[C@@H](O)[C@@]2(C)C[C@H]1c1ccccc1Br |
| InChI | InChI=1S/C21H30BrNO3/c1-20(2,3)26-19(25)23-16(14-9-5-6-10-15(14)22)13-21(4)17(23)11-7-8-12-18(21)24/h5-6,9-10,16-18,24H,7-8,11-13H2,1-4H3/t16-,17-,18+,21-/m0/s1 |
| InChIKey | XEIFVCXADPAIJV-UGNRZPKXSA-N |
| XLogP | 5.44 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |