C23H34N2O2 — CID 110134553
tert-butyl (1S,2R,4R,10R)-2-benzyl-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecane-12-carboxylate (PubChem CID 110134553) has the molecular formula C23H34N2O2 and a molecular weight of 370.54 g/mol. Its IUPAC name is tert-butyl (1S,2R,4R,10R)-2-benzyl-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecane-12-carboxylate.
| Compound Name | tert-butyl (1S,2R,4R,10R)-2-benzyl-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecane-12-carboxylate |
|---|---|
| PubChem CID | 110134553 |
| Molecular Formula | C23H34N2O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | tert-butyl (1S,2R,4R,10R)-2-benzyl-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecane-12-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCCC[C@H]3N[C@H](Cc4ccccc4)[C@@H]1C[C@@]23C |
| InChI | InChI=1S/C23H34N2O2/c1-22(2,3)27-21(26)25-18-15-23(4)19(12-8-9-13-20(23)25)24-17(18)14-16-10-6-5-7-11-16/h5-7,10-11,17-20,24H,8-9,12-15H2,1-4H3/t17-,18+,19-,20?,23-/m1/s1 |
| InChIKey | UJUZQOXUERKFEN-ZMJPCPHBSA-N |
| XLogP | 4.53 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |