C19H28N2 — CID 110138700
(1S,2S,4R,9S,10S)-2-benzyl-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecane (PubChem CID 110138700) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is (1S,2S,4R,9S,10S)-2-benzyl-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecane.
| Compound Name | (1S,2S,4R,9S,10S)-2-benzyl-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecane |
|---|---|
| PubChem CID | 110138700 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | (1S,2S,4R,9S,10S)-2-benzyl-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecane |
| SMILES | CN1[C@@H](Cc2ccccc2)[C@@H]2C[C@@]3(C)[C@H](CCCC[C@@H]13)N2 |
| InChI | InChI=1S/C19H28N2/c1-19-13-15-16(12-14-8-4-3-5-9-14)21(2)18(19)11-7-6-10-17(19)20-15/h3-5,8-9,15-18,20H,6-7,10-13H2,1-2H3/t15-,16-,17-,18+,19-/m0/s1 |
| InChIKey | OLBMUNVNIUFADC-FKSLSLAPSA-N |
| XLogP | 3.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |