C23H33N3O2 — CID 110140550
N-[2-[(1S,2R,4R,9S,10R)-2-benzyl-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-2-oxoethyl]acetamide (PubChem CID 110140550) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is N-[2-[(1S,2R,4R,9S,10R)-2-benzyl-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-2-oxoethyl]acetamide.
| Compound Name | N-[2-[(1S,2R,4R,9S,10R)-2-benzyl-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 110140550 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | N-[2-[(1S,2R,4R,9S,10R)-2-benzyl-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-2-oxoethyl]acetamide |
| SMILES | CC(=O)NCC(=O)N1[C@H]2CCCC[C@H]3N(C)[C@H](Cc4ccccc4)[C@@H]1C[C@@]23C |
| InChI | InChI=1S/C23H33N3O2/c1-16(27)24-15-22(28)26-19-14-23(2)20(11-7-8-12-21(23)26)25(3)18(19)13-17-9-5-4-6-10-17/h4-6,9-10,18-21H,7-8,11-15H2,1-3H3,(H,24,27)/t18-,19+,20-,21+,23-/m1/s1 |
| InChIKey | BLDQNEHAYRORIH-HVJVJISESA-N |
| XLogP | 2.60 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |