C25H35N3O2 — CID 110140691
1-[2-[(1S,2S,4R,9S,10R)-2-benzyl-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-2-oxoethyl]pyrrolidin-2-one (PubChem CID 110140691) has the molecular formula C25H35N3O2 and a molecular weight of 409.57 g/mol. Its IUPAC name is 1-[2-[(1S,2S,4R,9S,10R)-2-benzyl-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-2-oxoethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[(1S,2S,4R,9S,10R)-2-benzyl-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-2-oxoethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 110140691 |
| Molecular Formula | C25H35N3O2 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | 1-[2-[(1S,2S,4R,9S,10R)-2-benzyl-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-2-oxoethyl]pyrrolidin-2-one |
| SMILES | CN1[C@@H](Cc2ccccc2)[C@@H]2C[C@@]3(C)[C@H](CCCC[C@@H]13)N2C(=O)CN1CCCC1=O |
| InChI | InChI=1S/C25H35N3O2/c1-25-16-20-19(15-18-9-4-3-5-10-18)26(2)21(25)11-6-7-12-22(25)28(20)24(30)17-27-14-8-13-23(27)29/h3-5,9-10,19-22H,6-8,11-17H2,1-2H3/t19-,20-,21+,22-,25+/m0/s1 |
| InChIKey | KJIVDQFCKQLZJH-CZLVRFMKSA-N |
| XLogP | 3.08 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |