C26H34N4O2 — CID 110141476
1-[2-[(1S,2S,4R,8S,9R)-2-benzyl-3,9-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-11-yl]-2-oxoethyl]-4,6-dimethylpyrimidin-2-one (PubChem CID 110141476) has the molecular formula C26H34N4O2 and a molecular weight of 434.58 g/mol. Its IUPAC name is 1-[2-[(1S,2S,4R,8S,9R)-2-benzyl-3,9-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-11-yl]-2-oxoethyl]-4,6-dimethylpyrimidin-2-one.
| Compound Name | 1-[2-[(1S,2S,4R,8S,9R)-2-benzyl-3,9-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-11-yl]-2-oxoethyl]-4,6-dimethylpyrimidin-2-one |
|---|---|
| PubChem CID | 110141476 |
| Molecular Formula | C26H34N4O2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | 1-[2-[(1S,2S,4R,8S,9R)-2-benzyl-3,9-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-11-yl]-2-oxoethyl]-4,6-dimethylpyrimidin-2-one |
| SMILES | Cc1cc(C)n(CC(=O)N2[C@H]3CCC[C@H]4N(C)[C@@H](Cc5ccccc5)[C@@H]2C[C@@]34C)c(=O)n1 |
| InChI | InChI=1S/C26H34N4O2/c1-17-13-18(2)29(25(32)27-17)16-24(31)30-21-15-26(3)22(11-8-12-23(26)30)28(4)20(21)14-19-9-6-5-7-10-19/h5-7,9-10,13,20-23H,8,11-12,14-16H2,1-4H3/t20-,21-,22+,23-,26+/m0/s1 |
| InChIKey | MDEFRSYAHLKIFB-FMLGWJCWSA-N |
| XLogP | 2.95 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |