C24H32N4OS — CID 110141337
(2-amino-4-methyl-1,3-thiazol-5-yl)-[(1S,2S,4R,9S,10R)-2-benzyl-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]methanone (PubChem CID 110141337) has the molecular formula C24H32N4OS and a molecular weight of 424.61 g/mol. Its IUPAC name is (2-amino-4-methyl-1,3-thiazol-5-yl)-[(1S,2S,4R,9S,10R)-2-benzyl-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]methanone.
| Compound Name | (2-amino-4-methyl-1,3-thiazol-5-yl)-[(1S,2S,4R,9S,10R)-2-benzyl-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]methanone |
|---|---|
| PubChem CID | 110141337 |
| Molecular Formula | C24H32N4OS |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | (2-amino-4-methyl-1,3-thiazol-5-yl)-[(1S,2S,4R,9S,10R)-2-benzyl-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]methanone |
| SMILES | Cc1nc(N)sc1C(=O)N1[C@H]2CCCC[C@H]3N(C)[C@@H](Cc4ccccc4)[C@@H]1C[C@@]23C |
| InChI | InChI=1S/C24H32N4OS/c1-15-21(30-23(25)26-15)22(29)28-18-14-24(2)19(11-7-8-12-20(24)28)27(3)17(18)13-16-9-5-4-6-10-16/h4-6,9-10,17-20H,7-8,11-14H2,1-3H3,(H2,25,26)/t17-,18-,19+,20-,24+/m0/s1 |
| InChIKey | LIMUVJDEBWWEEN-BPJSAFFHSA-N |
| XLogP | 4.12 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |