C28H32N4OS — CID 110140405
[(1S,2S,4R,9S,10R)-2-benzyl-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-[2-(1,3-thiazol-5-yl)-3-pyridinyl]methanone (PubChem CID 110140405) has the molecular formula C28H32N4OS and a molecular weight of 472.66 g/mol. Its IUPAC name is [(1S,2S,4R,9S,10R)-2-benzyl-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-[2-(1,3-thiazol-5-yl)-3-pyridinyl]methanone.
| Compound Name | [(1S,2S,4R,9S,10R)-2-benzyl-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-[2-(1,3-thiazol-5-yl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 110140405 |
| Molecular Formula | C28H32N4OS |
| Molecular Weight | 472.66 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | [(1S,2S,4R,9S,10R)-2-benzyl-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-[2-(1,3-thiazol-5-yl)-3-pyridinyl]methanone |
| SMILES | CN1[C@@H](Cc2ccccc2)[C@@H]2C[C@@]3(C)[C@H](CCCC[C@@H]13)N2C(=O)c1cccnc1-c1cncs1 |
| InChI | InChI=1S/C28H32N4OS/c1-28-16-22-21(15-19-9-4-3-5-10-19)31(2)24(28)12-6-7-13-25(28)32(22)27(33)20-11-8-14-30-26(20)23-17-29-18-34-23/h3-5,8-11,14,17-18,21-22,24-25H,6-7,12-13,15-16H2,1-2H3/t21-,22-,24+,25-,28+/m0/s1 |
| InChIKey | NHGMZBUCYWDALH-ZEQWEQIFSA-N |
| XLogP | 5.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.66 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |