C25H34N4O — CID 110141395
1-[(1S,2S,4R,9S,10R)-2-benzyl-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-2-(4-methylpyrazol-1-yl)ethanone (PubChem CID 110141395) has the molecular formula C25H34N4O and a molecular weight of 406.57 g/mol. Its IUPAC name is 1-[(1S,2S,4R,9S,10R)-2-benzyl-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-2-(4-methylpyrazol-1-yl)ethanone.
| Compound Name | 1-[(1S,2S,4R,9S,10R)-2-benzyl-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-2-(4-methylpyrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 110141395 |
| Molecular Formula | C25H34N4O |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 1-[(1S,2S,4R,9S,10R)-2-benzyl-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-2-(4-methylpyrazol-1-yl)ethanone |
| SMILES | Cc1cnn(CC(=O)N2[C@H]3CCCC[C@H]4N(C)[C@@H](Cc5ccccc5)[C@@H]2C[C@@]34C)c1 |
| InChI | InChI=1S/C25H34N4O/c1-18-15-26-28(16-18)17-24(30)29-21-14-25(2)22(11-7-8-12-23(25)29)27(3)20(21)13-19-9-5-4-6-10-19/h4-6,9-10,15-16,20-23H,7-8,11-14,17H2,1-3H3/t20-,21-,22+,23-,25+/m0/s1 |
| InChIKey | HPIUHWBZZWDICA-LYVDORBWSA-N |
| XLogP | 3.67 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |