C25H32N4O2 — CID 110141043
2-[2-[(1S,2S,4R,8S,9S)-2-benzyl-9,11-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-2-oxoethyl]-6-methylpyridazin-3-one (PubChem CID 110141043) has the molecular formula C25H32N4O2 and a molecular weight of 420.56 g/mol. Its IUPAC name is 2-[2-[(1S,2S,4R,8S,9S)-2-benzyl-9,11-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-2-oxoethyl]-6-methylpyridazin-3-one.
| Compound Name | 2-[2-[(1S,2S,4R,8S,9S)-2-benzyl-9,11-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-2-oxoethyl]-6-methylpyridazin-3-one |
|---|---|
| PubChem CID | 110141043 |
| Molecular Formula | C25H32N4O2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | 2-[2-[(1S,2S,4R,8S,9S)-2-benzyl-9,11-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-2-oxoethyl]-6-methylpyridazin-3-one |
| SMILES | Cc1ccc(=O)n(CC(=O)N2[C@@H](Cc3ccccc3)[C@@H]3C[C@@]4(C)[C@H](CCC[C@@H]24)N3C)n1 |
| InChI | InChI=1S/C25H32N4O2/c1-17-12-13-23(30)28(26-17)16-24(31)29-19(14-18-8-5-4-6-9-18)20-15-25(2)21(27(20)3)10-7-11-22(25)29/h4-6,8-9,12-13,19-22H,7,10-11,14-16H2,1-3H3/t19-,20-,21-,22+,25-/m0/s1 |
| InChIKey | UUMGURPUZMDOPH-ZWCDFLAXSA-N |
| XLogP | 2.64 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |