C25H34N4O — CID 110140762
[(1S,2S,4R,8S,9S)-2-benzyl-9,11-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-(5-propan-2-yl-1H-pyrazol-3-yl)methanone (PubChem CID 110140762) has the molecular formula C25H34N4O and a molecular weight of 406.57 g/mol. Its IUPAC name is [(1S,2S,4R,8S,9S)-2-benzyl-9,11-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-(5-propan-2-yl-1H-pyrazol-3-yl)methanone.
| Compound Name | [(1S,2S,4R,8S,9S)-2-benzyl-9,11-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-(5-propan-2-yl-1H-pyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 110140762 |
| Molecular Formula | C25H34N4O |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | [(1S,2S,4R,8S,9S)-2-benzyl-9,11-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-(5-propan-2-yl-1H-pyrazol-3-yl)methanone |
| SMILES | CC(C)c1cc(C(=O)N2[C@@H](Cc3ccccc3)[C@@H]3C[C@@]4(C)[C@H](CCC[C@@H]24)N3C)n[nH]1 |
| InChI | InChI=1S/C25H34N4O/c1-16(2)18-14-19(27-26-18)24(30)29-20(13-17-9-6-5-7-10-17)21-15-25(3)22(28(21)4)11-8-12-23(25)29/h5-7,9-10,14,16,20-23H,8,11-13,15H2,1-4H3,(H,26,27)/t20-,21-,22-,23+,25-/m0/s1 |
| InChIKey | CESYFDAFIHGAGG-WHGMEAMLSA-N |
| XLogP | 4.23 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |