C27H36N4O2 — CID 110140781
1-[(1S,2S,4R,8S,9R)-2-benzyl-11-(5-tert-butyl-1H-pyrazole-3-carbonyl)-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]ethanone (PubChem CID 110140781) has the molecular formula C27H36N4O2 and a molecular weight of 448.61 g/mol. Its IUPAC name is 1-[(1S,2S,4R,8S,9R)-2-benzyl-11-(5-tert-butyl-1H-pyrazole-3-carbonyl)-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]ethanone.
| Compound Name | 1-[(1S,2S,4R,8S,9R)-2-benzyl-11-(5-tert-butyl-1H-pyrazole-3-carbonyl)-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]ethanone |
|---|---|
| PubChem CID | 110140781 |
| Molecular Formula | C27H36N4O2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | 1-[(1S,2S,4R,8S,9R)-2-benzyl-11-(5-tert-butyl-1H-pyrazole-3-carbonyl)-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]ethanone |
| SMILES | CC(=O)N1[C@@H](Cc2ccccc2)[C@@H]2C[C@@]3(C)[C@H](CCC[C@@H]13)N2C(=O)c1cc(C(C)(C)C)[nH]n1 |
| InChI | InChI=1S/C27H36N4O2/c1-17(32)30-20(14-18-10-7-6-8-11-18)21-16-27(5)23(30)12-9-13-24(27)31(21)25(33)19-15-22(29-28-19)26(2,3)4/h6-8,10-11,15,20-21,23-24H,9,12-14,16H2,1-5H3,(H,28,29)/t20-,21-,23+,24-,27+/m0/s1 |
| InChIKey | KUXQUKSDAJAAGZ-OUANPOPISA-N |
| XLogP | 4.32 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |