C28H38N4O2 — CID 155984157
1-[(1S,2R,4R,9S,10S)-2-benzyl-3-(5-tert-butyl-1H-pyrazole-3-carbonyl)-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]ethanone (PubChem CID 155984157) has the molecular formula C28H38N4O2 and a molecular weight of 462.64 g/mol. Its IUPAC name is 1-[(1S,2R,4R,9S,10S)-2-benzyl-3-(5-tert-butyl-1H-pyrazole-3-carbonyl)-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]ethanone.
| Compound Name | 1-[(1S,2R,4R,9S,10S)-2-benzyl-3-(5-tert-butyl-1H-pyrazole-3-carbonyl)-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]ethanone |
|---|---|
| PubChem CID | 155984157 |
| Molecular Formula | C28H38N4O2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | 1-[(1S,2R,4R,9S,10S)-2-benzyl-3-(5-tert-butyl-1H-pyrazole-3-carbonyl)-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]ethanone |
| SMILES | CC(=O)N1[C@H]2CCCC[C@H]3N(C(=O)c4cc(C(C)(C)C)[nH]n4)[C@H](Cc4ccccc4)[C@@H]1C[C@@]23C |
| InChI | InChI=1S/C28H38N4O2/c1-18(33)31-22-17-28(5)24(31)13-9-10-14-25(28)32(21(22)15-19-11-7-6-8-12-19)26(34)20-16-23(30-29-20)27(2,3)4/h6-8,11-12,16,21-22,24-25H,9-10,13-15,17H2,1-5H3,(H,29,30)/t21-,22+,24+,25-,28+/m1/s1 |
| InChIKey | FFQAYLVWILVGDA-RZZQBKOKSA-N |
| XLogP | 4.71 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |