C28H30N2O3 — CID 110140908
1-[(1S,2R,4R,8S,9S)-3-(1-benzofuran-2-carbonyl)-2-benzyl-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-11-yl]ethanone (PubChem CID 110140908) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is 1-[(1S,2R,4R,8S,9S)-3-(1-benzofuran-2-carbonyl)-2-benzyl-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-11-yl]ethanone.
| Compound Name | 1-[(1S,2R,4R,8S,9S)-3-(1-benzofuran-2-carbonyl)-2-benzyl-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-11-yl]ethanone |
|---|---|
| PubChem CID | 110140908 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 1-[(1S,2R,4R,8S,9S)-3-(1-benzofuran-2-carbonyl)-2-benzyl-9-methyl-3,11-diazatricyclo[6.2.1.04,9]undecan-11-yl]ethanone |
| SMILES | CC(=O)N1[C@H]2CCC[C@H]3N(C(=O)c4cc5ccccc5o4)[C@H](Cc4ccccc4)[C@@H]1C[C@@]23C |
| InChI | InChI=1S/C28H30N2O3/c1-18(31)29-22-17-28(2)25(29)13-8-14-26(28)30(21(22)15-19-9-4-3-5-10-19)27(32)24-16-20-11-6-7-12-23(20)33-24/h3-7,9-12,16,21-22,25-26H,8,13-15,17H2,1-2H3/t21-,22+,25+,26-,28+/m1/s1 |
| InChIKey | ASWVHVWGWHVLFB-RGXIMUQGSA-N |
| XLogP | 5.05 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |