C27H32N4O — CID 110141583
[(1S,2R,4R,8S,9S)-2-benzyl-9,11-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-(8-methylimidazo[1,2-a]pyridin-2-yl)methanone (PubChem CID 110141583) has the molecular formula C27H32N4O and a molecular weight of 428.58 g/mol. Its IUPAC name is [(1S,2R,4R,8S,9S)-2-benzyl-9,11-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-(8-methylimidazo[1,2-a]pyridin-2-yl)methanone.
| Compound Name | [(1S,2R,4R,8S,9S)-2-benzyl-9,11-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-(8-methylimidazo[1,2-a]pyridin-2-yl)methanone |
|---|---|
| PubChem CID | 110141583 |
| Molecular Formula | C27H32N4O |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | [(1S,2R,4R,8S,9S)-2-benzyl-9,11-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-3-yl]-(8-methylimidazo[1,2-a]pyridin-2-yl)methanone |
| SMILES | Cc1cccn2cc(C(=O)N3[C@H](Cc4ccccc4)[C@@H]4C[C@@]5(C)[C@H](CCC[C@@H]35)N4C)nc12 |
| InChI | InChI=1S/C27H32N4O/c1-18-9-8-14-30-17-20(28-25(18)30)26(32)31-21(15-19-10-5-4-6-11-19)22-16-27(2)23(29(22)3)12-7-13-24(27)31/h4-6,8-11,14,17,21-24H,7,12-13,15-16H2,1-3H3/t21-,22+,23+,24-,27+/m1/s1 |
| InChIKey | DSTGIHIBOXJIIQ-PFGYYQCGSA-N |
| XLogP | 4.34 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |