C29H34N4O2 — CID 110076195
[(1S,2S,4R,8S,9R)-2-benzyl-3,9-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-11-yl]-[3-(3-methoxyphenyl)-1H-pyrazol-5-yl]methanone (PubChem CID 110076195) has the molecular formula C29H34N4O2 and a molecular weight of 470.62 g/mol. Its IUPAC name is [(1S,2S,4R,8S,9R)-2-benzyl-3,9-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-11-yl]-[3-(3-methoxyphenyl)-1H-pyrazol-5-yl]methanone.
| Compound Name | [(1S,2S,4R,8S,9R)-2-benzyl-3,9-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-11-yl]-[3-(3-methoxyphenyl)-1H-pyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 110076195 |
| Molecular Formula | C29H34N4O2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | [(1S,2S,4R,8S,9R)-2-benzyl-3,9-dimethyl-3,11-diazatricyclo[6.2.1.04,9]undecan-11-yl]-[3-(3-methoxyphenyl)-1H-pyrazol-5-yl]methanone |
| SMILES | COc1cccc(-c2cc(C(=O)N3[C@H]4CCC[C@H]5N(C)[C@@H](Cc6ccccc6)[C@@H]3C[C@@]45C)[nH]n2)c1 |
| InChI | InChI=1S/C29H34N4O2/c1-29-18-25-24(15-19-9-5-4-6-10-19)32(2)26(29)13-8-14-27(29)33(25)28(34)23-17-22(30-31-23)20-11-7-12-21(16-20)35-3/h4-7,9-12,16-17,24-27H,8,13-15,18H2,1-3H3,(H,30,31)/t24-,25-,26+,27-,29+/m0/s1 |
| InChIKey | XZUDHYOSXKPHDU-DYXRGMLLSA-N |
| XLogP | 4.78 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |