C25H32N4O4 — CID 110141150
1-[(1S,4R,9S,10R)-12-[3-(2,5-dimethoxyphenyl)-1H-pyrazole-5-carbonyl]-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-3-yl]ethanone (PubChem CID 110141150) has the molecular formula C25H32N4O4 and a molecular weight of 452.56 g/mol. Its IUPAC name is 1-[(1S,4R,9S,10R)-12-[3-(2,5-dimethoxyphenyl)-1H-pyrazole-5-carbonyl]-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-3-yl]ethanone.
| Compound Name | 1-[(1S,4R,9S,10R)-12-[3-(2,5-dimethoxyphenyl)-1H-pyrazole-5-carbonyl]-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-3-yl]ethanone |
|---|---|
| PubChem CID | 110141150 |
| Molecular Formula | C25H32N4O4 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 1-[(1S,4R,9S,10R)-12-[3-(2,5-dimethoxyphenyl)-1H-pyrazole-5-carbonyl]-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-3-yl]ethanone |
| SMILES | COc1ccc(OC)c(-c2cc(C(=O)N3[C@@H]4CN(C(C)=O)[C@@H]5CCCC[C@H]3[C@]5(C)C4)[nH]n2)c1 |
| InChI | InChI=1S/C25H32N4O4/c1-15(30)28-14-16-13-25(2)22(28)7-5-6-8-23(25)29(16)24(31)20-12-19(26-27-20)18-11-17(32-3)9-10-21(18)33-4/h9-12,16,22-23H,5-8,13-14H2,1-4H3,(H,26,27)/t16-,22+,23-,25+/m0/s1 |
| InChIKey | XSZZCJCAYWEXCH-VZYCYIEDSA-N |
| XLogP | 3.49 |
| TPSA | 87.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |