C22H32N2O4 — CID 110141360
2-(2,6-dimethoxyphenoxy)-1-[(1S,4R,9S,10R)-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]ethanone (PubChem CID 110141360) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is 2-(2,6-dimethoxyphenoxy)-1-[(1S,4R,9S,10R)-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]ethanone.
| Compound Name | 2-(2,6-dimethoxyphenoxy)-1-[(1S,4R,9S,10R)-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]ethanone |
|---|---|
| PubChem CID | 110141360 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 2-(2,6-dimethoxyphenoxy)-1-[(1S,4R,9S,10R)-3,10-dimethyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]ethanone |
| SMILES | COc1cccc(OC)c1OCC(=O)N1[C@@H]2CN(C)[C@@H]3CCCC[C@H]1[C@]3(C)C2 |
| InChI | InChI=1S/C22H32N2O4/c1-22-12-15-13-23(2)18(22)10-5-6-11-19(22)24(15)20(25)14-28-21-16(26-3)8-7-9-17(21)27-4/h7-9,15,18-19H,5-6,10-14H2,1-4H3/t15-,18+,19-,22+/m0/s1 |
| InChIKey | CXBKMDLFZKBCNW-TUXJCPBXSA-N |
| XLogP | 2.95 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |