C19H28N2O4 — CID 110141356
1-[(4aS,8aR)-4a-methyl-2,3,4,5,6,7,8,8a-octahydro-1,5-naphthyridin-1-yl]-2-(2,6-dimethoxyphenoxy)ethanone (PubChem CID 110141356) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is 1-[(4aS,8aR)-4a-methyl-2,3,4,5,6,7,8,8a-octahydro-1,5-naphthyridin-1-yl]-2-(2,6-dimethoxyphenoxy)ethanone.
| Compound Name | 1-[(4aS,8aR)-4a-methyl-2,3,4,5,6,7,8,8a-octahydro-1,5-naphthyridin-1-yl]-2-(2,6-dimethoxyphenoxy)ethanone |
|---|---|
| PubChem CID | 110141356 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 1-[(4aS,8aR)-4a-methyl-2,3,4,5,6,7,8,8a-octahydro-1,5-naphthyridin-1-yl]-2-(2,6-dimethoxyphenoxy)ethanone |
| SMILES | COc1cccc(OC)c1OCC(=O)N1CCC[C@]2(C)NCCC[C@@H]12 |
| InChI | InChI=1S/C19H28N2O4/c1-19-10-6-12-21(16(19)9-5-11-20-19)17(22)13-25-18-14(23-2)7-4-8-15(18)24-3/h4,7-8,16,20H,5-6,9-13H2,1-3H3/t16-,19+/m1/s1 |
| InChIKey | GGQBCPXXHJKMBY-APWZRJJASA-N |
| XLogP | 2.22 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |