C22H26FN3O — CID 110133490
[(4aS,8aR)-4a-methyl-2,3,4,5,6,7,8,8a-octahydro-1,5-naphthyridin-1-yl]-[2-[(3-fluorophenyl)methyl]-4-pyridinyl]methanone (PubChem CID 110133490) has the molecular formula C22H26FN3O and a molecular weight of 367.47 g/mol. Its IUPAC name is [(4aS,8aR)-4a-methyl-2,3,4,5,6,7,8,8a-octahydro-1,5-naphthyridin-1-yl]-[2-[(3-fluorophenyl)methyl]-4-pyridinyl]methanone.
| Compound Name | [(4aS,8aR)-4a-methyl-2,3,4,5,6,7,8,8a-octahydro-1,5-naphthyridin-1-yl]-[2-[(3-fluorophenyl)methyl]-4-pyridinyl]methanone |
|---|---|
| PubChem CID | 110133490 |
| Molecular Formula | C22H26FN3O |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | [(4aS,8aR)-4a-methyl-2,3,4,5,6,7,8,8a-octahydro-1,5-naphthyridin-1-yl]-[2-[(3-fluorophenyl)methyl]-4-pyridinyl]methanone |
| SMILES | C[C@]12CCCN(C(=O)c3ccnc(Cc4cccc(F)c4)c3)[C@@H]1CCCN2 |
| InChI | InChI=1S/C22H26FN3O/c1-22-9-4-12-26(20(22)7-3-10-25-22)21(27)17-8-11-24-19(15-17)14-16-5-2-6-18(23)13-16/h2,5-6,8,11,13,15,20,25H,3-4,7,9-10,12,14H2,1H3/t20-,22+/m1/s1 |
| InChIKey | PNOCUBAYKPPHBZ-IRLDBZIGSA-N |
| XLogP | 3.56 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |